6-(4-METHYLPHENYL)-3-THIOXO-3,4-DIHYDRO-1,2,4-TRIAZIN-5(2H)-ONE structure
|
Common Name | 6-(4-METHYLPHENYL)-3-THIOXO-3,4-DIHYDRO-1,2,4-TRIAZIN-5(2H)-ONE | ||
|---|---|---|---|---|
| CAS Number | 27623-05-8 | Molecular Weight | 219.26300 | |
| Density | 1.4g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(4-methylphenyl)-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.26300 |
| Exact Mass | 219.04700 |
| PSA | 93.63000 |
| LogP | 1.80290 |
| Index of Refraction | 1.707 |
| InChIKey | ZHWHQITXIZRAGM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2n[nH]c(=S)[nH]c2=O)cc1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| hms1751b06 |