4-(5-PIPERIDIN-4-YL-1,2,4-OXADIAZOL-3-YL)PYRIDINE
Modify Date: 2025-12-09 20:00:57
4-(5-PIPERIDIN-4-YL-1,2,4-OXADIAZOL-3-YL)PYRIDINE structure
|
Common Name | 4-(5-PIPERIDIN-4-YL-1,2,4-OXADIAZOL-3-YL)PYRIDINE | ||
|---|---|---|---|---|
| CAS Number | 276237-03-7 | Molecular Weight | 230.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-piperidin-4-yl-3-pyridin-4-yl-1,2,4-oxadiazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14N4O |
|---|---|
| Molecular Weight | 230.26600 |
| Exact Mass | 230.11700 |
| PSA | 63.84000 |
| LogP | 1.92740 |
| InChIKey | OAAGDVLVOKMRCQ-UHFFFAOYSA-N |
| SMILES | c1cc(-c2noc(C3CCNCC3)n2)ccn1 |
|
~%
4-(5-PIPERIDIN-... CAS#:276237-03-7 |
| Literature: US2012/35143 A1, ; |
|
~%
4-(5-PIPERIDIN-... CAS#:276237-03-7 |
| Literature: US2012/35143 A1, ; |
|
~%
4-(5-PIPERIDIN-... CAS#:276237-03-7 |
| Literature: US2012/35143 A1, ; |
![(R)-2-(2-chloro-5-oxo-6,7-dihydro-5H-5λ4-thieno[3,2-d]pyrimidin-4-ylamino)-3-methyl-butan-1-ol structure](https://image.chemsrc.com/caspic/135/1143575-83-0.png)
![2,4-Dichloro-6,7-dihydrothieno[3,2-d]pyrimidine structure](https://image.chemsrc.com/caspic/048/74901-69-2.png)
![(R)-2-(2-chloro-6,7-dihydro-thieno[3,2-d]pyrimidin-4-ylamino)-3-methyl-butan-1-ol structure](https://image.chemsrc.com/caspic/183/1143575-82-9.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: ULK1_INH_LUMI_1536_1X%INH PRUN
|
|
Name: USP8 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 8
External Id: USP8 FAST DUB HTS Primary
|
|
Name: USP17 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 17 like family member 5
External Id: USP17 FAST DUB HTS Primary
|
|
Name: USP7 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 7
External Id: USP7 FAST DUB HTS Primary
|
|
Name: USP28 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 28
External Id: USP28 FAST DUB HTS Primary
|
|
Name: USP10 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 10
External Id: USP10 FAST DUB HTS Primary
|
|
Name: UCHL1 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin C-terminal hydrolase L1
External Id: UCHL1 FAST DUB HTS Primary
|
|
Name: OTUD3 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: OTU deubiquitinase 3
External Id: OTUD3 FAST DUB HTS Primary
|
|
Name: USP30 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 30
External Id: USP30 FAST DUB HTS Primary
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
Total 12, Current Page 1 of 2
1
2
| 4-[5-(piperidin-4-yl)-[1,2,4]-oxadiazol-3-yl]-pyridine |
| 5-(piperidin-4-yl)-3-(pyridin-4-yl)-1,2,4-oxadiazole |