L-Serine,N-[(1,1-dimethylethoxy)carbonyl]-, hydrazide structure
|
Common Name | L-Serine,N-[(1,1-dimethylethoxy)carbonyl]-, hydrazide | ||
|---|---|---|---|---|
| CAS Number | 2766-42-9 | Molecular Weight | 219.23800 | |
| Density | 1.215g/cm3 | Boiling Point | 460.8ºC at 760 mmHg | |
| Molecular Formula | C8H17N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.5ºC | |
| Name | tert-butyl N-(1-hydrazinyl-3-hydroxy-1-oxopropan-2-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.215g/cm3 |
|---|---|
| Boiling Point | 460.8ºC at 760 mmHg |
| Molecular Formula | C8H17N3O4 |
| Molecular Weight | 219.23800 |
| Flash Point | 232.5ºC |
| Exact Mass | 219.12200 |
| PSA | 113.68000 |
| LogP | 0.34400 |
| Vapour Pressure | 1.98E-10mmHg at 25°C |
| Index of Refraction | 1.5 |
| InChIKey | PWWLFQFIVAGVEV-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CO)C(=O)NN |
|
~%
L-Serine,N-[(1,... CAS#:2766-42-9 |
| Literature: Storey; Beacham; Cernosek; Finn; Yanaihara; Hofmann Journal of the American Chemical Society, 1972 , vol. 94, # 17 p. 6170 - 6178 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Boc-Ser(PO3Ph2)-OH |
| Boc-Ser-NHNH2 |
| N-(t-Butoxycarbonyl)-(L)-serine hydrazide |
| BOC-O-DIMETHYLPHOSPHO-L-SERINE |
| Boc-Ser-N2H3 |
| N-BOC-Ser-hydrazid |