4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole
Modify Date: 2026-07-20 06:10:01
![4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole Structure](https://www.chemsrc.com/extcaspic/476/2766979-26-2.png)
4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole structure
|
Common Name | 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole | ||
|---|---|---|---|---|
| CAS Number | 2766979-26-2 | Molecular Weight | 288.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17BN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H17BN2O2S |
|---|---|
| Molecular Weight | 288.2 |
| InChIKey | XNUFHNMSRXSRTC-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2ccc(-c3csnn3)cc2)OC1(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole? |
| A: CAS number of 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole is 2766979-26-2. |
| Q: What is the molecular formula of 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole? |
| A: Molecular formula of 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole is C14H17BN2O2S. |
| Q: What is the SMILES notation of 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole? |
| A: SMILES notation of 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole is CC1(C)OB(c2ccc(-c3csnn3)cc2)OC1(C)C. |
| Q: What is the Chinese name of 2766979-26-2? |
| A: Chinese name of 2766979-26-2 is 2766979-26-2. |
| Q: What is the molecular weight of 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole? |
| A: Molecular weight of 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole is 288.2. |
| Q: What is the InChIKey of 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole? |
| A: InChIKey of 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole is XNUFHNMSRXSRTC-UHFFFAOYSA-N. |
| Q: What is the English name of 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole? |
| A: The English name of 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole is 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,3-thiadiazole. |