6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol
Modify Date: 2025-09-30 23:18:48
6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol structure
|
Common Name | 6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol | ||
|---|---|---|---|---|
| CAS Number | 2767133-16-2 | Molecular Weight | 250.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18N2O3 |
|---|---|
| Molecular Weight | 250.29 |
| InChIKey | OBOOSIBOBKVOMW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1Cc2cccnc2C(O)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2767133-16-2? |
| A: Chinese name of 2767133-16-2 is 2767133-16-2. |
| Q: What is the SMILES notation of 6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol? |
| A: SMILES notation of 6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol is CC(C)(C)OC(=O)N1Cc2cccnc2C(O)C1. |
| Q: What is the molecular weight of 6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol? |
| A: Molecular weight of 6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol is 250.29. |
| Q: What is the molecular formula of 6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol? |
| A: Molecular formula of 6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol is C13H18N2O3. |
| Q: What is the InChIKey of 6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol? |
| A: InChIKey of 6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol is OBOOSIBOBKVOMW-UHFFFAOYSA-N. |
| Q: What is the CAS number of 6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol? |
| A: CAS number of 6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol is 2767133-16-2. |
| Q: What is the English name of 6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol? |
| A: The English name of 6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol is 6-Boc-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol. |