4-Benzoyl-2-phenylbutyric acid structure
|
Common Name | 4-Benzoyl-2-phenylbutyric acid | ||
|---|---|---|---|---|
| CAS Number | 27687-47-4 | Molecular Weight | 268.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-oxo-2,5-diphenylpentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H16O3 |
|---|---|
| Molecular Weight | 268.30700 |
| Exact Mass | 268.11000 |
| PSA | 54.37000 |
| LogP | 3.51790 |
| InChIKey | MFANFOUDLIGXSQ-UHFFFAOYSA-N |
| SMILES | O=C(CCC(C(=O)O)c1ccccc1)c1ccccc1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-Benzoyl-2-phenylbutyric acid |