N-(4-hydroxyphenyl)-2-phenyl-butanamide structure
|
Common Name | N-(4-hydroxyphenyl)-2-phenyl-butanamide | ||
|---|---|---|---|---|
| CAS Number | 2769-41-7 | Molecular Weight | 255.31200 | |
| Density | 1.185g/cm3 | Boiling Point | 484.6ºC at 760mmHg | |
| Molecular Formula | C16H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.9ºC | |
| Name | N-(4-Hydroxyphenyl)-2-phenylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.185g/cm3 |
|---|---|
| Boiling Point | 484.6ºC at 760mmHg |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.31200 |
| Flash Point | 246.9ºC |
| Exact Mass | 255.12600 |
| PSA | 49.33000 |
| LogP | 3.59750 |
| Vapour Pressure | 5.13E-10mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | CABKEOHFJPXTDL-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)Nc1ccc(O)cc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-(4-hydroxyphe... CAS#:2769-41-7 |
| Literature: Carissimi Farmaco, Edizione Scientifica, 1958 , vol. 13, p. 817,821 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4'-Hydroxy-2-phenylbutyranilide |
| 2-Phenyl-buttersaeure-(4-hydroxy-anilid) |
| BUTYRANILIDE,4'-HYDROXY-2-PHENYL |
| 2-phenyl-butyric acid-(4-hydroxy-anilide) |