S-Triazine-2,4,6(1H,3H,5H)-trione, 1-benzyl-3,5-diallyl-, structure
|
Common Name | S-Triazine-2,4,6(1H,3H,5H)-trione, 1-benzyl-3,5-diallyl-, | ||
|---|---|---|---|---|
| CAS Number | 27694-82-2 | Molecular Weight | 299.32400 | |
| Density | 1.217g/cm3 | Boiling Point | 448.8ºC at 760mmHg | |
| Molecular Formula | C16H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.9ºC | |
| Name | 1-benzyl-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 448.8ºC at 760mmHg |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.32400 |
| Flash Point | 196.9ºC |
| Exact Mass | 299.12700 |
| PSA | 66.00000 |
| LogP | 0.59200 |
| Vapour Pressure | 3.01E-08mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | RPZFNZAMUHPNCZ-UHFFFAOYSA-N |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(Cc2ccccc2)c1=O |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| Benzyl-diallyl-isocyanurat |
| 1,3-diallyl-5-benzyl-[1,3,5]triazinane-2,4,6-trione |
| S-Triazine-2,4,6(1H,3H,5H)-trione,1-benzyl-3,5-diallyl |