7-(3-chloropropyl)-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione structure
|
Common Name | 7-(3-chloropropyl)-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 2770-66-3 | Molecular Weight | 256.68900 | |
| Density | 1.45g/cm3 | Boiling Point | 473.2ºC at 760mmHg | |
| Molecular Formula | C10H13ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240ºC | |
| Name | 7-(3-chloropropyl)-1,3-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 473.2ºC at 760mmHg |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.68900 |
| Flash Point | 240ºC |
| Exact Mass | 256.07300 |
| PSA | 61.82000 |
| LogP | 0.06260 |
| Vapour Pressure | 4.02E-09mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | MORVOYPJRATMRS-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(ncn2CCCCl)n(C)c1=O |
| HS Code | 2933990090 |
|---|
|
~90%
7-(3-chloroprop... CAS#:2770-66-3 |
| Literature: Kim, Soon-Ai; Marshall, Melissa A.; Melman, Neli; Kim, Hak Sung; Mueller, Christa E.; Linden, Joel; Jacobson, Kenneth A. Journal of Medicinal Chemistry, 2002 , vol. 45, # 11 p. 2131 - 2138 |
|
~93%
7-(3-chloroprop... CAS#:2770-66-3 |
| Literature: Kalcheva, Veneta B.; Apostolova, Tatiana M.; Anakieva, Violeta Z. Journal fuer Praktische Chemie (Leipzig), 1985 , vol. 327, # 1 p. 165 - 168 |
|
~55%
7-(3-chloroprop... CAS#:2770-66-3 |
| Literature: Kalcheva, Veneta B.; Apostolova, Tatiana M.; Anakieva, Violeta Z. Journal fuer Praktische Chemie (Leipzig), 1985 , vol. 327, # 1 p. 165 - 168 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 220-462-9 |
| 3,7-Dihydro-7-(3-chloropropyl)-1,3-dimethyl-1H-purine-2,6-dione |
| 7-(3-chloropropyl)-1,3-dimethyl-3,7-dihydro-1h-purine-2,6-dione |
| 7-(3-chloropropyl)theophylline |
| 1H-Purine-2,6-dione,3,7-dihydro-7-(3-chloropropyl)-1,3-dimethyl |
| 7-(3-chloro-propan-1-yl)-theophylline |
| (Chloro-3 propyl)-7 theophylline [French] |
| 7-(3-chloro-propyl)-1,3-dimethyl-3,7-dihydro-purine-2,6-dione |
| Theophylline,7-(3-chloropropyl) |
| 7-(3-Chloropropyl)-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione |
| 7-(3-Chloropropyl)-1,3-dimethylxanthine |