R(-)-octyl tosylate
Modify Date: 2025-08-25 02:45:25
R(-)-octyl tosylate structure
|
Common Name | R(-)-octyl tosylate | ||
|---|---|---|---|---|
| CAS Number | 27770-99-6 | Molecular Weight | 284.41400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | R(-)-octyl tosylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H24O3S |
|---|---|
| Molecular Weight | 284.41400 |
| Exact Mass | 284.14500 |
| PSA | 51.75000 |
| LogP | 5.14000 |
| InChIKey | RZLKOKZEQUNTFC-DDWIOCJRSA-N |
| SMILES | CCCCCCC(C)O.Cc1ccc(S(=O)(=O)O)cc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (R)-octan-2-yl methylbenzenesulfonate |
| (-)-(R)-2-octyl p-toluenesulfonate |
| (-)-(R)-2-octyl-p-toluenesulfonate |
| R-(-)-2-p-toluenesulfonate octane |
| R(-) 2-octyl p-toluenesulfonate |
| (-)-(R)-2-Octanol tosylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of R(-)-octyl tosylate? |
| A: The English name of R(-)-octyl tosylate is R(-)-octyl tosylate. |
| Q: What is the molecular weight of R(-)-octyl tosylate? |
| A: Molecular weight of R(-)-octyl tosylate is 284.41400. |
| Q: What English synonyms does R(-)-octyl tosylate have? |
| A: English synonyms of R(-)-octyl tosylate: (R)-octan-2-yl methylbenzenesulfonate, (-)-(R)-2-octyl p-toluenesulfonate, (-)-(R)-2-octyl-p-toluenesulfonate, R-(-)-2-p-toluenesulfonate octane, R(-) 2-octyl p-toluenesulfonate, (-)-(R)-2-Octanol tosylate. |
| Q: What is the Chinese name of 27770-99-6? |
| A: Chinese name of 27770-99-6 is 27770-99-6. |
| Q: What is the CAS number of R(-)-octyl tosylate? |
| A: CAS number of R(-)-octyl tosylate is 27770-99-6. |
| Q: What is the LogP of R(-)-octyl tosylate? |
| A: LogP of R(-)-octyl tosylate is 5.14000. |
| Q: What is the molecular formula of R(-)-octyl tosylate? |
| A: Molecular formula of R(-)-octyl tosylate is C15H24O3S. |
| Q: What is the polar surface area (PSA) of R(-)-octyl tosylate? |
| A: Polar surface area (PSA) of R(-)-octyl tosylate is 51.75000. |
| Q: What is the InChIKey of R(-)-octyl tosylate? |
| A: InChIKey of R(-)-octyl tosylate is RZLKOKZEQUNTFC-DDWIOCJRSA-N. |
| Q: What is the SMILES notation of R(-)-octyl tosylate? |
| A: SMILES notation of R(-)-octyl tosylate is CCCCCCC(C)O.Cc1ccc(S(=O)(=O)O)cc1. |