2-Ethoxy-5-fluoro-N,N-dimethyl-β-(1-methylpropyl)benzeneethanamine structure
|
Common Name | 2-Ethoxy-5-fluoro-N,N-dimethyl-β-(1-methylpropyl)benzeneethanamine | ||
|---|---|---|---|---|
| CAS Number | 27778-82-1 | Molecular Weight | 267.38200 | |
| Density | 0.974g/cm3 | Boiling Point | 337.2ºC at 760 mmHg | |
| Molecular Formula | C16H26FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.7ºC | |
| Name | 2-(2-Ethoxy-5-fluorophenyl)-N,N,3-trimethyl-1-pentanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.974g/cm3 |
|---|---|
| Boiling Point | 337.2ºC at 760 mmHg |
| Molecular Formula | C16H26FNO |
| Molecular Weight | 267.38200 |
| Flash Point | 157.7ºC |
| Exact Mass | 267.20000 |
| PSA | 12.47000 |
| LogP | 3.91570 |
| Vapour Pressure | 0.000107mmHg at 25°C |
| Index of Refraction | 1.484 |
| InChIKey | STXLVWICZNDMHD-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(F)cc1C(CN(C)C)C(C)CC |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| xmd8-92 |