2''-Chloro-3,4-dimethoxybenzoin structure
|
Common Name | 2''-Chloro-3,4-dimethoxybenzoin | ||
|---|---|---|---|---|
| CAS Number | 27819-71-2 | Molecular Weight | 306.74100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-chlorophenyl)-1-(3,4-dimethoxyphenyl)-2-hydroxyethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15ClO4 |
|---|---|
| Molecular Weight | 306.74100 |
| Exact Mass | 306.06600 |
| PSA | 55.76000 |
| LogP | 3.27350 |
| InChIKey | VVRDNTAUUYOMEQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C(O)c2ccccc2Cl)cc1OC |
| HS Code | 2914700090 |
|---|
|
~79%
2''-Chloro-3,4-... CAS#:27819-71-2 |
| Literature: Procuranti, Barbara; Connon, Stephen J. Chemical Communications, 2007 , # 14 p. 1421 - 1423 |
|
~%
2''-Chloro-3,4-... CAS#:27819-71-2 |
| Literature: American Cyanamid Company Patent: US4344954 A1, 1982 ; |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2'-Chlor-3,4-dimethoxy-benzoin |
| Ethanone,2-(2-chlorophenyl)-1-(3,4-dimethoxyphenyl)-2-hydroxy |
| 2'-Chloro-3,4-dimethoxybenzoin |
| Benzoin,2'-chloro-3,4-dimethoxy-(8CI) |