Thymidine-5'-triphosphate trisodium salt structure
|
Common Name | Thymidine-5'-triphosphate trisodium salt | ||
|---|---|---|---|---|
| CAS Number | 27821-54-1 | Molecular Weight | 548.114 | |
| Density | 1.922g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14N2Na3O14P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thymidine-5'-triphosphate trisodium saltDeoxythymidine-5'-triphosphate (dTTP) trisodium salt is one of the four natural deoxynucleotides. Deoxythymidine-5'-triphosphate trisodium salt is used for the biosynthesis of deoxyribonucleic acid by DNA polymerase and reverse transcriptase[1]. |
| Name | thymidine 5'-(trisodium hydrogen triphosphate) |
|---|---|
| Synonym | More Synonyms |
| Description | Deoxythymidine-5'-triphosphate (dTTP) trisodium salt is one of the four natural deoxynucleotides. Deoxythymidine-5'-triphosphate trisodium salt is used for the biosynthesis of deoxyribonucleic acid by DNA polymerase and reverse transcriptase[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.922g/cm3 |
|---|---|
| Molecular Formula | C10H14N2Na3O14P3 |
| Molecular Weight | 548.114 |
| Exact Mass | 547.935120 |
| PSA | 282.06000 |
| LogP | 0.15130 |
| InChIKey | NHVNXKFIZYSCEB-UHFFFAOYSA-N |
| SMILES | Cc1cn(C2CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]c1=O |
| Storage condition | 2-8℃ |
| Thymidine, 5'-(tetrahydrogen triphosphate), sodium salt (1:3) |
| thymidine 5'-(trisod |
| Thymidine-5'-TriphosphateTetrasodium |
| Thymidine-5'-triphosphate trisodium salt |
| Trisodium 5'-O-[({[(hydroxyphosphinato)oxy]phosphinato}oxy)phosphinato]thymidine |
| Thymidine-5'-Triphosphoric Acid Trisodium Salt |
| Thymidine 5'-(tetrahydrogen triphosphate) trisodium salt |
| TTP-Na3 |