6-(4-methylphenyl)-3,4-dihydro-2H-1,5-benzoxazocin-3-ol structure
|
Common Name | 6-(4-methylphenyl)-3,4-dihydro-2H-1,5-benzoxazocin-3-ol | ||
|---|---|---|---|---|
| CAS Number | 27827-60-7 | Molecular Weight | 267.32200 | |
| Density | 1.17g/cm3 | Boiling Point | 417.3ºC at 760mmHg | |
| Molecular Formula | C17H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.2ºC | |
| Name | 6-(4-methylphenyl)-3,4-dihydro-2H-1,5-benzoxazocin-3-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 417.3ºC at 760mmHg |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.32200 |
| Flash Point | 206.2ºC |
| Exact Mass | 267.12600 |
| PSA | 41.82000 |
| LogP | 2.02130 |
| Vapour Pressure | 1.03E-07mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | IVUWKRONGZCNSP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C2=NCC(O)COc3ccccc32)cc1 |
|
~%
6-(4-methylphen... CAS#:27827-60-7 |
| Literature: Basil,B. et al. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 403 - 406 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2H-1,5-Benzoxazocin-3-ol,3,4-dihydro-6-p-tolyl-,hemihydrate |
| 6-p-Tolyl-3,4-dihydro-2H-1,5-benzoxazocin-3-ol hemihydrate |
| 6-p-tolyl-3,4-dihydro-2H-benzo[b][1,5]oxazocin-3-ol |
| (5z)-6-(4-methylphenyl)-3,4-dihydro-2h-1,5-benzoxazocin-3-ol |