3-methyl-2-[2-methyl-3-(3-methyl-3H-benzothiazol-2-ylidene)prop-1-enyl]benzothiazolium iodide structure
|
Common Name | 3-methyl-2-[2-methyl-3-(3-methyl-3H-benzothiazol-2-ylidene)prop-1-enyl]benzothiazolium iodide | ||
|---|---|---|---|---|
| CAS Number | 2783-73-5 | Molecular Weight | 478.41300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H19IN2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-2-[2-methyl-3-(3-methyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-1,3-benzothiazole,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H19IN2S2 |
|---|---|
| Molecular Weight | 478.41300 |
| Exact Mass | 478.00300 |
| PSA | 65.29000 |
| LogP | 1.44810 |
| InChIKey | SYAZKCDPODSEIR-UHFFFAOYSA-M |
| SMILES | CC(=Cc1sc2ccccc2[n+]1C)C=C1Sc2ccccc2N1C.[I-] |
|
~%
3-methyl-2-[2-m... CAS#:2783-73-5 |
| Literature: Hishiki Kagaku Kenkyusho Hokoku, 1952 , vol. 28, p. 250,253 Chem.Abstr., 1953 , p. 4771 |
|
~%
3-methyl-2-[2-m... CAS#:2783-73-5 |
| Literature: Hamer Journal of the Chemical Society, 1928 , p. 3162 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,3',9-trimethylthiacarbocyanine iodide |
| 1,3-Benzoxathiole-2-acetic acid,2-methyl |
| 2-Methyl-1,3-benzoxathiol-2-essigsaeure |
| 2-methyl-1,3-bis-(3-methyl-benzothiazol-2-yl)-trimethinium,iodide |
| 2-Methyl-1,3-bis-(3-methyl-benzothiazol-2-yl)-trimethinium,Jodid |
| 3-methyl-2-[2-methyl-3-(3-methyl-3H-benzothiazol-2-ylidene)prop-1-enyl]benzothiazolium iodide |
| (2-methyl-benzo[1,3]oxathiol-2-yl)-acetic acid |