Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+)
Modify Date: 2026-07-04 18:49:53
Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+) structure
|
Common Name | Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+) | ||
|---|---|---|---|---|
| CAS Number | 27855-06-7 | Molecular Weight | 204.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16OSi |
|---|---|
| Molecular Weight | 204.34 |
| InChIKey | IUAXIKXNYUWSIQ-CQSZACIVSA-N |
| SMILES | C[Si]1(c2ccccc2)CCCCC1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+)? |
| A: The English name of Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+) is Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+). |
| Q: What is the InChIKey of Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+)? |
| A: InChIKey of Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+) is IUAXIKXNYUWSIQ-CQSZACIVSA-N. |
| Q: What is the Chinese name of 27855-06-7? |
| A: Chinese name of 27855-06-7 is 27855-06-7. |
| Q: What is the SMILES notation of Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+)? |
| A: SMILES notation of Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+) is C[Si]1(c2ccccc2)CCCCC1=O. |
| Q: What is the CAS number of Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+)? |
| A: CAS number of Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+) is 27855-06-7. |
| Q: What is the molecular weight of Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+)? |
| A: Molecular weight of Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+) is 204.34. |
| Q: What is the molecular formula of Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+)? |
| A: Molecular formula of Silacyclohexan-2-one, 1-methyl-1-phenyl-, (R)-(+) is C12H16OSi. |