Silane, (4-(dimethylsilyl)phenyl)trimethyl- structure
|
Common Name | Silane, (4-(dimethylsilyl)phenyl)trimethyl- | ||
|---|---|---|---|---|
| CAS Number | 27856-24-2 | Molecular Weight | 208.44700 | |
| Density | N/A | Boiling Point | 226.4ºC at 760mmHg | |
| Molecular Formula | C11H20Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 90.7ºC | |
| Name | [4-(Dimethylsilyl)phenyl](trimethyl)silane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 226.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C11H20Si2 |
| Molecular Weight | 208.44700 |
| Flash Point | 90.7ºC |
| Exact Mass | 208.11000 |
| LogP | 1.92550 |
| Vapour Pressure | 0.123mmHg at 25°C |
| InChIKey | KEKSTDVRSQBNGX-UHFFFAOYSA-N |
| SMILES | C[SiH](C)c1ccc([Si](C)(C)C)cc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| <m-(Dimethylsilyl)-phenyl>-trimethylsilan |
| [m-(Dimethylsilyl)-phenyl]-trimethoxysilan |
| <p-(Dimethylsilyl)phenyl>-trimethoxysilan |
| p-Trimethylsilylphenyldimethylsilan |
| <p-(Dimethylsilyl)phenyl>-trimethylsilan |
| Silane,(3-(dimethylsilyl)phenyl)trimethoxy |