N-[(4-tolyl)sulphonyl]-L-glutamic acid, compound with 2,3,5,6-tetrahydro-6-phenylimidazo[2,1-b]thiazole (1:1) structure
|
Common Name | N-[(4-tolyl)sulphonyl]-L-glutamic acid, compound with 2,3,5,6-tetrahydro-6-phenylimidazo[2,1-b]thiazole (1:1) | ||
|---|---|---|---|---|
| CAS Number | 27863-17-8 | Molecular Weight | 505.607 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H27N3O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(4-Methylphenyl)sulfonyl]-L-glutamic acid-(6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H27N3O6S2 |
|---|---|
| Molecular Weight | 505.607 |
| Exact Mass | 505.134125 |
| InChIKey | GBSJSWQLBOZWTA-QTFBQHTASA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC(CCC(=O)O)C(=O)O)cc1.c1ccc(C2CN3CCSC3=N2)cc1 |
| N-[(4-Methylphenyl)sulfonyl]-L-glutamic acid - (6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (1:1) |
| L-Glutamic acid, N-[(4-methylphenyl)sulfonyl]-, compd. with (6S)-2,3,5,6-tetrahydro-6-phenylimidazo[2,1-b]thiazole (1:1) |
| EINECS 248-699-3 |