1-[Bis(1-methylpropyl)amino]-3-(tricyclo[3.3.1.13,7]decan-1-ylmethoxy)-2-propanol structure
|
Common Name | 1-[Bis(1-methylpropyl)amino]-3-(tricyclo[3.3.1.13,7]decan-1-ylmethoxy)-2-propanol | ||
|---|---|---|---|---|
| CAS Number | 27866-08-6 | Molecular Weight | 351.56600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H41NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(1-adamantylmethoxy)-3-[di(butan-2-yl)amino]propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H41NO2 |
|---|---|
| Molecular Weight | 351.56600 |
| Exact Mass | 351.31400 |
| PSA | 32.70000 |
| LogP | 4.47930 |
| Vapour Pressure | 6.36E-10mmHg at 25°C |
| InChIKey | HFDZAMYXLQSMOA-UHFFFAOYSA-N |
| SMILES | CCC(C)N(CC(O)COCC12CC3CC(CC(C3)C1)C2)C(C)CC |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-[Bis(1-methylpropyl)amino]-3-(tricyclo[3.3.1.13,7]decan-1-ylmethoxy)-2-propanol |
| 2-Propanol,1-(bis(1-methylpropyl)amino)-3-(tricyclo(3.3.1.13,7)dec-1-ylmethoxy) |
| 1-(1-Adamantylmethoxy)-3-(di-2-butylamino)-2-propanol |
| 2-Propanol,1-(1-adamantylmethoxy)-3-(di-2-butylamino) |