Phenyl 3,4,6-Tri-O-acetyl-2-deoxy-1-thio-2-(2,2,2-trichloroethoxyformamido)-beta-D-galactopyranoside structure
|
Common Name | Phenyl 3,4,6-Tri-O-acetyl-2-deoxy-1-thio-2-(2,2,2-trichloroethoxyformamido)-beta-D-galactopyranoside | ||
|---|---|---|---|---|
| CAS Number | 278784-83-1 | Molecular Weight | 572.84100 | |
| Density | 1.457g/cm3 | Boiling Point | 633.127ºC at 760 mmHg | |
| Molecular Formula | C21H24Cl3NO9S | Melting Point | 117 °C | |
| MSDS | N/A | Flash Point | 336.703ºC | |
| Name | [(2S,3R,4R,5S,6S)-3,4-diacetyloxy-6-phenylsulfanyl-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate |
|---|
| Density | 1.457g/cm3 |
|---|---|
| Boiling Point | 633.127ºC at 760 mmHg |
| Melting Point | 117 °C |
| Molecular Formula | C21H24Cl3NO9S |
| Molecular Weight | 572.84100 |
| Flash Point | 336.703ºC |
| Exact Mass | 571.02400 |
| PSA | 155.25000 |
| LogP | 3.59950 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | AZDNCEYOFMNMSH-FQBWVUSXSA-N |
| SMILES | CC(=O)OCC1OC(Sc2ccccc2)C(NC(=O)OCC(Cl)(Cl)Cl)C(OC(C)=O)C1OC(C)=O |
|
~73%
Phenyl 3,4,6-Tr... CAS#:278784-83-1 |
| Literature: Nitz, Mark; Bundle, David R. Journal of Organic Chemistry, 2000 , vol. 65, # 10 p. 3064 - 3073 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |