(2-carbonochloridoyl-6-methylphenyl) acetate structure
|
Common Name | (2-carbonochloridoyl-6-methylphenyl) acetate | ||
|---|---|---|---|---|
| CAS Number | 27893-05-6 | Molecular Weight | 212.63000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-carbonochloridoyl-6-methylphenyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9ClO3 |
|---|---|
| Molecular Weight | 212.63000 |
| Exact Mass | 212.02400 |
| PSA | 43.37000 |
| LogP | 2.29930 |
| InChIKey | IUMLXMMQIRVXME-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1c(C)cccc1C(=O)Cl |
|
~%
(2-carbonochlor... CAS#:27893-05-6 |
| Literature: Przhiyalgovskaya, N. M.; Kon'kov, L. I.; Kurkovskaya, L. N.; Mandzhikov, V. F. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1987 , vol. 23, # 10 p. 1078 - 1081 Khimiya Geterotsiklicheskikh Soedinenii, 1987 , # 10 p. 1346 - 1349 |
|
~%
(2-carbonochlor... CAS#:27893-05-6 |
| Literature: Yu, Kuo-Long; Ruediger, Edward; Luo, Guangxiang; Cianci, Christopher; Danetz, Stephanie; Tiley, Laurence; Trehan, Ashok K.; Monkovic, Ivo; Pearce, Bradley; Martel, Alain; Krystal, Mark; Meanwell, Nicholas A. Bioorganic and Medicinal Chemistry Letters, 1999 , vol. 9, # 15 p. 2177 - 2180 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Acetic acid 2-chlorocarbonyl-6-methyl-phenyl ester |
| 2-acetoxy-3-methylbenzoic acid chloride |
| 2-acetoxy-3-methyl-benzoyl chloride |
| 2-Acetoxy-3-methyl-benzoylchlorid |
| Acetyl-o-kresotinsaeure-chlorid |
| 2-Acetoxy-3-methyl-benzoesaeure-chlorid |
| Benzoyl chloride,2-(acetyloxy)-3-methyl |