1-deoxy-1-(ethylamino)-D-glucitol, compound with 4-hydroxy-3-iodo-5-nitrobenzonitrile (1:1) structure
|
Common Name | 1-deoxy-1-(ethylamino)-D-glucitol, compound with 4-hydroxy-3-iodo-5-nitrobenzonitrile (1:1) | ||
|---|---|---|---|---|
| CAS Number | 27917-82-4 | Molecular Weight | 279.032 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 254.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H6INO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 107.6±25.9 °C | |
| Name | 2485 |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 254.4±35.0 °C at 760 mmHg |
| Molecular Formula | C7H6INO3 |
| Molecular Weight | 279.032 |
| Flash Point | 107.6±25.9 °C |
| Exact Mass | 278.939240 |
| LogP | 3.30 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | NIVIZBHSVXAGNW-ANJNCBFHSA-N |
| SMILES | CCNCC(O)C(O)C(O)C(O)CO.N#Cc1cc(I)c(O)c([N+](=O)[O-])c1 |
| EINECS 248-726-9 |
| 9L0EXQ7125 |
| Phenol, 2-iodo-4-methyl-6-nitro- |
| 2485 |
| 2-Iodo-4-methyl-6-nitrophenol |
| EINECS 216-884-8 |