6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one
Modify Date: 2025-08-22 13:32:51
6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one structure
|
Common Name | 6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 2792185-75-0 | Molecular Weight | 253.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9BrN2O |
|---|---|
| Molecular Weight | 253.09 |
| InChIKey | FFVPBJPADJYOPC-UHFFFAOYSA-N |
| SMILES | Cn1cc(Br)c(=O)c2cc(N)ccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one? |
| A: Molecular weight of 6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one is 253.09. |
| Q: What is the English name of 6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one? |
| A: The English name of 6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one is 6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one. |
| Q: What is the CAS number of 6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one? |
| A: CAS number of 6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one is 2792185-75-0. |
| Q: What is the Chinese name of 2792185-75-0? |
| A: Chinese name of 2792185-75-0 is 2792185-75-0. |
| Q: What is the molecular formula of 6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one? |
| A: Molecular formula of 6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one is C10H9BrN2O. |
| Q: What is the SMILES notation of 6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one? |
| A: SMILES notation of 6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one is Cn1cc(Br)c(=O)c2cc(N)ccc21. |
| Q: What is the InChIKey of 6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one? |
| A: InChIKey of 6-Amino-3-bromo-1-methyl-1,4-dihydroquinolin-4-one is FFVPBJPADJYOPC-UHFFFAOYSA-N. |