4,4'-methylenebis[3-hydroxy-2-naphthoic] acid, compound with (2S-trans)-3,4-dimethyl-2-phenylmorpholine (1:2) structure
|
Common Name | 4,4'-methylenebis[3-hydroxy-2-naphthoic] acid, compound with (2S-trans)-3,4-dimethyl-2-phenylmorpholine (1:2) | ||
|---|---|---|---|---|
| CAS Number | 27922-80-1 | Molecular Weight | 579.63900 | |
| Density | N/A | Boiling Point | 642.7ºC at 760 mmHg | |
| Molecular Formula | C35H33NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 356.5ºC | |
| Name | 4-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylic acid,3,4-dimethyl-2-phenylmorpholine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 642.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C35H33NO7 |
| Molecular Weight | 579.63900 |
| Flash Point | 356.5ºC |
| Exact Mass | 579.22600 |
| PSA | 127.53000 |
| LogP | 6.40750 |
| Vapour Pressure | 2.13E-17mmHg at 25°C |
| InChIKey | YQJDXBJFQQFWTN-RARUPOKRSA-N |
| SMILES | CC1C(c2ccccc2)OCCN1C.CC1C(c2ccccc2)OCCN1C.O=C(O)c1cc2ccccc2c(Cc2c(O)c(C(=O)O)cc3ccccc23)c1O |
| 3,4-dimethyl-2-phenyl-morpholine |
| 4,4'-Methylenebis(3-hydroxy-2-naphthoic) acid,compound with (2S-trans)-3,4-dimethyl-2-phenylmorpholine (1:2) |
| EINECS 248-730-0 |
| 4-[(3-carboxy-2-hydroxy-naphthalen-1-yl)methyl]-3-hydroxy-naphthalene-2-carboxylic acid |