Phosphonic acid,1-piperidinyl-, dibutyl ester (9CI) structure
|
Common Name | Phosphonic acid,1-piperidinyl-, dibutyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 27933-07-9 | Molecular Weight | 277.34000 | |
| Density | 1.02g/cm3 | Boiling Point | 339.8ºC at 760mmHg | |
| Molecular Formula | C13H28NO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.3ºC | |
| Name | 1-dibutoxyphosphorylpiperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 339.8ºC at 760mmHg |
| Molecular Formula | C13H28NO3P |
| Molecular Weight | 277.34000 |
| Flash Point | 159.3ºC |
| Exact Mass | 277.18100 |
| PSA | 48.58000 |
| LogP | 4.15170 |
| Vapour Pressure | 8.96E-05mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | BFOUZAPQGBSNGK-UHFFFAOYSA-N |
| SMILES | CCCCOP(=O)(OCCCC)N1CCCCC1 |
| HS Code | 2933399090 |
|---|
|
~73%
Phosphonic acid... CAS#:27933-07-9 |
| Literature: Sener, Sadiye; Mete, Ahmet Synthetic Communications, 1997 , vol. 27, # 2 p. 307 - 313 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| piperidin-1-yl-phosphonic acid dibutyl ester |
| dibutyl piperidin-1-ylphosphonate |
| di-n-butyl piperidinophosphonate |