N-benzyl-2-chloro-2-phenylacetamide
Modify Date: 2025-08-27 07:21:12
N-benzyl-2-chloro-2-phenylacetamide structure
|
Common Name | N-benzyl-2-chloro-2-phenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 27946-19-6 | Molecular Weight | 259.73100 | |
| Density | 1.194g/cm3 | Boiling Point | 458.6ºC at 760mmHg | |
| Molecular Formula | C15H14ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.2ºC | |
| Name | N-benzyl-2-chloro-2-phenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.194g/cm3 |
|---|---|
| Boiling Point | 458.6ºC at 760mmHg |
| Molecular Formula | C15H14ClNO |
| Molecular Weight | 259.73100 |
| Flash Point | 231.2ºC |
| Exact Mass | 259.07600 |
| PSA | 32.59000 |
| LogP | 4.12320 |
| Vapour Pressure | 1.35E-08mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | PPKWFXHUJIGMNJ-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccccc1)C(Cl)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-benzyl-2-chloro-2-phenylethanamide |
| Chlor-phenyl-essigsaeure-benzylamid |
| Acetamide,N-benzyl-2-chloro-2-phenyl |
| C-Chlor-C-phenyl-N-benzyl-acetamid |
| chloro-phenyl-acetic acid benzylamide |