Pentafluorophenyl thiocyanate
Modify Date: 2025-09-25 15:43:06
Pentafluorophenyl thiocyanate structure
|
Common Name | Pentafluorophenyl thiocyanate | ||
|---|---|---|---|---|
| CAS Number | 27976-75-6 | Molecular Weight | 225.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7F5NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Pentafluorophenyl thiocyanate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7F5NS |
|---|---|
| Molecular Weight | 225.14 |
| InChIKey | BPKSEAUIHGRFPO-UHFFFAOYSA-N |
| SMILES | N#CSc1c(F)c(F)c(F)c(F)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Pentafluorophenyl thiocyanate? |
| A: The English name of Pentafluorophenyl thiocyanate is Pentafluorophenyl thiocyanate. |
| Q: What is the molecular formula of Pentafluorophenyl thiocyanate? |
| A: Molecular formula of Pentafluorophenyl thiocyanate is C7F5NS. |
| Q: What is the molecular weight of Pentafluorophenyl thiocyanate? |
| A: Molecular weight of Pentafluorophenyl thiocyanate is 225.14. |
| Q: What is the InChIKey of Pentafluorophenyl thiocyanate? |
| A: InChIKey of Pentafluorophenyl thiocyanate is BPKSEAUIHGRFPO-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 27976-75-6? |
| A: Chinese name of 27976-75-6 is 27976-75-6. |
| Q: What is the SMILES notation of Pentafluorophenyl thiocyanate? |
| A: SMILES notation of Pentafluorophenyl thiocyanate is N#CSc1c(F)c(F)c(F)c(F)c1F. |
| Q: What is the CAS number of Pentafluorophenyl thiocyanate? |
| A: CAS number of Pentafluorophenyl thiocyanate is 27976-75-6. |