Methanesulfonamide,N-[2-[(4-aminophenyl)ethylamino]ethyl] structure
|
Common Name | Methanesulfonamide,N-[2-[(4-aminophenyl)ethylamino]ethyl] | ||
|---|---|---|---|---|
| CAS Number | 2800-11-5 | Molecular Weight | 257.35200 | |
| Density | 1.23g/cm3 | Boiling Point | 438.3ºC at 760 mmHg | |
| Molecular Formula | C11H19N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.9ºC | |
| Name | N-[2-(4-amino-N-ethylanilino)ethyl]methanesulfonamide |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 438.3ºC at 760 mmHg |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.35200 |
| Flash Point | 218.9ºC |
| Exact Mass | 257.12000 |
| PSA | 83.81000 |
| LogP | 2.69720 |
| Vapour Pressure | 6.98E-08mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | CWPNUVRPRDFMNR-UHFFFAOYSA-N |
| SMILES | CCN(CCNS(C)(=O)=O)c1ccc(N)cc1 |
|
~%
Methanesulfonam... CAS#:2800-11-5 |
| Literature: Bent et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3100,3101 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |