Benzyl 3-methyl-5-vinylbenzoate
Modify Date: 2026-07-14 22:42:23
Benzyl 3-methyl-5-vinylbenzoate structure
|
Common Name | Benzyl 3-methyl-5-vinylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 2802575-14-8 | Molecular Weight | 252.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzyl 3-methyl-5-vinylbenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H16O2 |
|---|---|
| Molecular Weight | 252.31 |
| InChIKey | JWAPCWCLJDIUAF-UHFFFAOYSA-N |
| SMILES | C=Cc1cc(C)cc(C(=O)OCc2ccccc2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Benzyl 3-methyl-5-vinylbenzoate? |
| A: Molecular weight of Benzyl 3-methyl-5-vinylbenzoate is 252.31. |
| Q: What is the CAS number of Benzyl 3-methyl-5-vinylbenzoate? |
| A: CAS number of Benzyl 3-methyl-5-vinylbenzoate is 2802575-14-8. |
| Q: What is the SMILES notation of Benzyl 3-methyl-5-vinylbenzoate? |
| A: SMILES notation of Benzyl 3-methyl-5-vinylbenzoate is C=Cc1cc(C)cc(C(=O)OCc2ccccc2)c1. |
| Q: What is the English name of Benzyl 3-methyl-5-vinylbenzoate? |
| A: The English name of Benzyl 3-methyl-5-vinylbenzoate is Benzyl 3-methyl-5-vinylbenzoate. |
| Q: What is the InChIKey of Benzyl 3-methyl-5-vinylbenzoate? |
| A: InChIKey of Benzyl 3-methyl-5-vinylbenzoate is JWAPCWCLJDIUAF-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2802575-14-8? |
| A: Chinese name of 2802575-14-8 is 2802575-14-8. |
| Q: What is the molecular formula of Benzyl 3-methyl-5-vinylbenzoate? |
| A: Molecular formula of Benzyl 3-methyl-5-vinylbenzoate is C17H16O2. |