2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate
Modify Date: 2025-09-04 18:56:56
2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate structure
|
Common Name | 2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 2802575-53-5 | Molecular Weight | 251.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10FNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10FNO4 |
|---|---|
| Molecular Weight | 251.21 |
| InChIKey | URXZYUDOVWTQEC-UHFFFAOYSA-N |
| SMILES | Cc1cc(F)ccc1C(=O)ON1C(=O)CCC1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate? |
| A: Molecular weight of 2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate is 251.21. |
| Q: What is the English name of 2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate? |
| A: The English name of 2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate is 2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate. |
| Q: What is the CAS number of 2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate? |
| A: CAS number of 2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate is 2802575-53-5. |
| Q: What is the SMILES notation of 2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate? |
| A: SMILES notation of 2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate is Cc1cc(F)ccc1C(=O)ON1C(=O)CCC1=O. |
| Q: What is the Chinese name of 2802575-53-5? |
| A: Chinese name of 2802575-53-5 is 2802575-53-5. |
| Q: What is the InChIKey of 2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate? |
| A: InChIKey of 2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate is URXZYUDOVWTQEC-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate? |
| A: Molecular formula of 2,5-Dioxopyrrolidin-1-yl 4-fluoro-2-methylbenzoate is C12H10FNO4. |