1H-Indol-5-amine,3-ethyl-N,N,1,2-tetramethyl- structure
|
Common Name | 1H-Indol-5-amine,3-ethyl-N,N,1,2-tetramethyl- | ||
|---|---|---|---|---|
| CAS Number | 28027-41-0 | Molecular Weight | 216.32200 | |
| Density | 0.99g/cm3 | Boiling Point | 354.8ºC at 760 mmHg | |
| Molecular Formula | C14H20N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.4ºC | |
| Name | 3-ethyl-N,N,1,2-tetramethylindol-5-amine |
|---|
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 354.8ºC at 760 mmHg |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.32200 |
| Flash Point | 168.4ºC |
| Exact Mass | 216.16300 |
| PSA | 8.17000 |
| LogP | 3.11510 |
| Vapour Pressure | 3.27E-05mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | MVBMCSOTTKNKHD-UHFFFAOYSA-N |
| SMILES | CCc1c(C)n(C)c2ccc(N(C)C)cc12 |
|
~%
1H-Indol-5-amin... CAS#:28027-41-0 |
| Literature: Fludzinski; Wittenauer; Schenck; Cohen Journal of Medicinal Chemistry, 1986 , vol. 29, # 11 p. 2415 - 2418 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |