1H-Indole-3-ethanamine,2-methyl-5-nitro structure
|
Common Name | 1H-Indole-3-ethanamine,2-methyl-5-nitro | ||
|---|---|---|---|---|
| CAS Number | 28027-52-3 | Molecular Weight | 219.24000 | |
| Density | 1.316g/cm3 | Boiling Point | 439.6ºC at 760 mmHg | |
| Molecular Formula | C11H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.7ºC | |
| Name | 2-(2-methyl-5-nitro-1H-indol-3-yl)ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 439.6ºC at 760 mmHg |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24000 |
| Flash Point | 219.7ºC |
| Exact Mass | 219.10100 |
| PSA | 87.63000 |
| LogP | 3.10920 |
| Vapour Pressure | 6.29E-08mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | CVTNZTGTHNNCTN-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c2ccc([N+](=O)[O-])cc2c1CCN |
|
~%
1H-Indole-3-eth... CAS#:28027-52-3 |
| Literature: Shaw; Woolley Journal of the American Chemical Society, 1953 , vol. 75, p. 1877,1880 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-(2-methyl-5-nitro-1H-indol-3-yl)-ethylamine |
| 2-(2-Methyl-5-nitro-indol-3-yl)-aethylamin |
| 2-(2-methyl-5-nitro-indol-3-yl)-ethylamine |