trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester
Modify Date: 2025-09-09 12:05:52
trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester structure
|
Common Name | trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 2805287-97-0 | Molecular Weight | 229.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H23NO3 |
|---|---|
| Molecular Weight | 229.32 |
| InChIKey | MMMVAIAUVIUSBN-JOYOIKCWSA-N |
| SMILES | CC1(O)CCCC(NC(=O)OC(C)(C)C)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2805287-97-0? |
| A: Chinese name of 2805287-97-0 is 2805287-97-0. |
| Q: What is the English name of trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester? |
| A: The English name of trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester is trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester. |
| Q: What is the SMILES notation of trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester? |
| A: SMILES notation of trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester is CC1(O)CCCC(NC(=O)OC(C)(C)C)C1. |
| Q: What is the molecular weight of trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester? |
| A: Molecular weight of trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester is 229.32. |
| Q: What is the CAS number of trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester? |
| A: CAS number of trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester is 2805287-97-0. |
| Q: What is the molecular formula of trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester? |
| A: Molecular formula of trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester is C12H23NO3. |
| Q: What is the InChIKey of trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester? |
| A: InChIKey of trans-(3-Hydroxy-3-methyl-cyclohexyl)-carbamic acid tert-butyl ester is MMMVAIAUVIUSBN-JOYOIKCWSA-N. |