Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester
Modify Date: 2026-09-25 11:08:59
Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester structure
|
Common Name | Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester | ||
|---|---|---|---|---|
| CAS Number | 28071-17-2 | Molecular Weight | 420.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H40O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H40O5 |
|---|---|
| Molecular Weight | 420.6 |
| InChIKey | RYTXBFUFNOVAOB-WKGRRQNDSA-N |
| SMILES | COC(=O)CCC(C)C1CCC2C3C(=O)C(O)C4CC(O)CCC4(C)C3CCC12C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester? |
| A: CAS number of Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester is 28071-17-2. |
| Q: What is the English name of Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester? |
| A: The English name of Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester is Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester. |
| Q: What is the molecular weight of Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester? |
| A: Molecular weight of Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester is 420.6. |
| Q: What is the SMILES notation of Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester? |
| A: SMILES notation of Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester is COC(=O)CCC(C)C1CCC2C3C(=O)C(O)C4CC(O)CCC4(C)C3CCC12C. |
| Q: What is the molecular formula of Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester? |
| A: Molecular formula of Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester is C25H40O5. |
| Q: What is the InChIKey of Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester? |
| A: InChIKey of Methyl 3,6-dihydroxy-7-oxo-cholan-24-oic Acid Ester is RYTXBFUFNOVAOB-WKGRRQNDSA-N. |
| Q: What is the Chinese name of 28071-17-2? |
| A: Chinese name of 28071-17-2 is 28071-17-2. |