2,6-dimethyl-1-cyclohexen-1-yl triflate
2,6-dimethyl-1-cyclohexen-1-yl triflate structure
|
Common Name | 2,6-dimethyl-1-cyclohexen-1-yl triflate | ||
|---|---|---|---|---|
| CAS Number | 28075-36-7 | Molecular Weight | 258.25800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13F3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2,6-Dimethyl-1-cyclohexen-1-yl triflate, Chinese name: 2,6-二甲基-1-环己烯-1-基三氟甲磺酸酯, CAS number: 28075-36-7, molecular formula: C9H13F3O3S, molecular weight: 258.26. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-dimethyl-1-cyclohexen-1-yl triflate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13F3O3S |
|---|---|
| Molecular Weight | 258.25800 |
| Exact Mass | 258.05400 |
| PSA | 51.75000 |
| LogP | 4.02740 |
| InChIKey | VXCNMFGZVNZJEZ-UHFFFAOYSA-N |
| SMILES | CC1=C(OS(=O)(=O)C(F)(F)F)C(C)CCC1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,6-dimethyl-cyclohex-1-en-1-yl trifluoromethanesulfonate |
| 2,6-dimethyl-cyclohex-1-enyl trifluoromethanesulfonate |
| 2,6-Dimethyl-1-cyclohexen-1-yl-triflat |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2,6-dimethyl-1-cyclohexen-1-yl triflate have? |
| A: English synonyms of 2,6-dimethyl-1-cyclohexen-1-yl triflate: 2,6-dimethyl-cyclohex-1-en-1-yl trifluoromethanesulfonate, 2,6-dimethyl-cyclohex-1-enyl trifluoromethanesulfonate, 2,6-Dimethyl-1-cyclohexen-1-yl-triflat. |
| Q: What is the LogP of 2,6-dimethyl-1-cyclohexen-1-yl triflate? |
| A: LogP of 2,6-dimethyl-1-cyclohexen-1-yl triflate is 4.02740. |
| Q: What is the polar surface area (PSA) of 2,6-dimethyl-1-cyclohexen-1-yl triflate? |
| A: Polar surface area (PSA) of 2,6-dimethyl-1-cyclohexen-1-yl triflate is 51.75000. |
| Q: What is the InChIKey of 2,6-dimethyl-1-cyclohexen-1-yl triflate? |
| A: InChIKey of 2,6-dimethyl-1-cyclohexen-1-yl triflate is VXCNMFGZVNZJEZ-UHFFFAOYSA-N. |
| Q: What is the English name of 2,6-dimethyl-1-cyclohexen-1-yl triflate? |
| A: The English name of 2,6-dimethyl-1-cyclohexen-1-yl triflate is 2,6-dimethyl-1-cyclohexen-1-yl triflate. |
| Q: What is the Chinese name of 28075-36-7? |
| A: Chinese name of 28075-36-7 is 28075-36-7. |
| Q: What is the CAS number of 2,6-dimethyl-1-cyclohexen-1-yl triflate? |
| A: CAS number of 2,6-dimethyl-1-cyclohexen-1-yl triflate is 28075-36-7. |
| Q: What is the molecular formula of 2,6-dimethyl-1-cyclohexen-1-yl triflate? |
| A: Molecular formula of 2,6-dimethyl-1-cyclohexen-1-yl triflate is C9H13F3O3S. |
| Q: What is the molecular weight of 2,6-dimethyl-1-cyclohexen-1-yl triflate? |
| A: Molecular weight of 2,6-dimethyl-1-cyclohexen-1-yl triflate is 258.25800. |
| Q: What is the SMILES notation of 2,6-dimethyl-1-cyclohexen-1-yl triflate? |
| A: SMILES notation of 2,6-dimethyl-1-cyclohexen-1-yl triflate is CC1=C(OS(=O)(=O)C(F)(F)F)C(C)CCC1. |