1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone
1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone structure
|
Common Name | 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 28077-35-2 | Molecular Weight | 264.32200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-(3,5-Dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone, CAS number: 28077-35-2, molecular formula: C17H16N2O, molecular weight: 264.32200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H16N2O |
|---|---|
| Molecular Weight | 264.32200 |
| Exact Mass | 264.12600 |
| PSA | 34.89000 |
| LogP | 3.53600 |
| InChIKey | VFRITOOEVYPSNM-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n(C(=O)Cc2cccc3ccccc23)n1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Contractile Force Screening of ChemBridge Diverset library for asthma drug discovery
Source: 24015
Target: N/A
External Id: HSPH_Screening_CFS_002
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N1-[α-Naphthyl-acetyl]-3,5-dimethyl-pyrazol |
| 3,5-dimethyl-1-(naphthalen-1-yl-acetyl)-1H-pyrazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone? |
| A: SMILES notation of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone is Cc1cc(C)n(C(=O)Cc2cccc3ccccc23)n1. |
| Q: What is the polar surface area (PSA) of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone? |
| A: Polar surface area (PSA) of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone is 34.89000. |
| Q: What is the English name of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone? |
| A: The English name of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone is 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone. |
| Q: What is the CAS number of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone? |
| A: CAS number of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone is 28077-35-2. |
| Q: What is the Chinese name of 28077-35-2? |
| A: Chinese name of 28077-35-2 is 28077-35-2. |
| Q: What English synonyms does 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone have? |
| A: English synonyms of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone: N1-[α-Naphthyl-acetyl]-3,5-dimethyl-pyrazol, 3,5-dimethyl-1-(naphthalen-1-yl-acetyl)-1H-pyrazole. |
| Q: What is the molecular weight of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone? |
| A: Molecular weight of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone is 264.32200. |
| Q: What is the InChIKey of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone? |
| A: InChIKey of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone is VFRITOOEVYPSNM-UHFFFAOYSA-N. |
| Q: What is the LogP of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone? |
| A: LogP of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone is 3.53600. |
| Q: What is the molecular formula of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone? |
| A: Molecular formula of 1-(3,5-dimethyl-1H-pyrazol-1-yl)-2-(naphth-1-yl)ethanone is C17H16N2O. |