2,3-dihydro-5-methoxy-7,8-dimethyl-2-phenyl-4H-1-benzopyran-4-one structure
|
Common Name | 2,3-dihydro-5-methoxy-7,8-dimethyl-2-phenyl-4H-1-benzopyran-4-one | ||
|---|---|---|---|---|
| CAS Number | 2812-09-1 | Molecular Weight | 282.33400 | |
| Density | 1.182g/cm3 | Boiling Point | 481.6ºC at 760mmHg | |
| Molecular Formula | C18H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.2ºC | |
| Name | 5-Methoxy-7,8-dimethyl-2-phenyl-2,3-dihydro-4H-chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 481.6ºC at 760mmHg |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.33400 |
| Flash Point | 214.2ºC |
| Exact Mass | 282.12600 |
| PSA | 35.53000 |
| LogP | 4.01850 |
| Vapour Pressure | 1.97E-09mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | HZLLFRKBXPNHCV-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c(C)c2c1C(=O)CC(c1ccccc1)O2 |
|
~69%
2,3-dihydro-5-m... CAS#:2812-09-1 |
| Literature: Solladie, Guy; Gehrold, Nicolai; Maignan, Jean European Journal of Organic Chemistry, 1999 , # 9 p. 2309 - 2314 |
|
~%
2,3-dihydro-5-m... CAS#:2812-09-1 |
| Literature: Rani, Indu Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1987 , vol. 26, # 1-12 p. 1080 - 1081 |
|
~%
2,3-dihydro-5-m... CAS#:2812-09-1 |
| Literature: Rani, Indu Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1987 , vol. 26, # 1-12 p. 1080 - 1081 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5,7-Dimethoxy-8-methyl-2-phenyl-chroman-4-on |
| 5,7-Dimethoxy-8-methyl-flavanon |
| 5,7-dimethoxy-8-methyl-2-phenyl-chroman-4-one |
| Isoaurentiacin |
| dimethylcryptostrobin |
| Toddaculin |
| 2,3-dihydro-5-methoxy-7,8-dimethyl-2-phenyl-4H-1-benzopyran-4-one |
| 5,7-dimethoxy-6-(3-methyl-but-2-enyl)-chromen-2-one |
| 5,7-dimethoxy-6-(3'-methyl-2'-butenyl)coumarin |
| 5,7-dimethoxy-8-methylflavanone |
| 2H-1-Benzopyran-2-one,5,7-dimethoxy-6-(3-methyl-2-butenyl) |