Methyl 4-(piperidin-4-yl)benzoate structure
|
Common Name | Methyl 4-(piperidin-4-yl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 281235-04-9 | Molecular Weight | 219.28000 | |
| Density | 1.071g/cm3 | Boiling Point | 340.3ºC at 760 mmHg | |
| Molecular Formula | C13H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.6ºC | |
| Name | methyl 4-piperidin-4-ylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.071g/cm3 |
|---|---|
| Boiling Point | 340.3ºC at 760 mmHg |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28000 |
| Flash Point | 159.6ºC |
| Exact Mass | 219.12600 |
| PSA | 38.33000 |
| LogP | 2.26900 |
| Vapour Pressure | 8.65E-05mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | GKSBLGJAXZOORS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C2CCNCC2)cc1 |
| Storage condition | 2-8°C |
| HS Code | 2933399090 |
|---|
|
~83%
Methyl 4-(piper... CAS#:281235-04-9 |
| Literature: US2004/242572 A1, ; Page/Page column 75 ; |
|
~95%
Methyl 4-(piper... CAS#:281235-04-9 |
| Literature: US2008/153812 A1, ; Page/Page column 123 ; US 20080153812 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-piperidin-4-ylbenzoic acid methyl ester |