[(4-methylphenyl)amino]methanesulfonic acid structure
|
Common Name | [(4-methylphenyl)amino]methanesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 28141-40-4 | Molecular Weight | 224.23300 | |
| Density | 1.4g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H11NNaO3S+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,(4-methylanilino)methanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Molecular Formula | C8H11NNaO3S+ |
| Molecular Weight | 224.23300 |
| Exact Mass | 224.03600 |
| PSA | 74.78000 |
| LogP | 2.40600 |
| Index of Refraction | 1.612 |
| InChIKey | ONOAYDIBQWDVBW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NCS(=O)(=O)O.[Na+] |
|
~%
[(4-methylpheny... CAS#:28141-40-4 |
| Literature: Bad. Anilin- u. Sodaf. Patent: DE156760 ; |
|
~%
[(4-methylpheny... CAS#:28141-40-4 |
| Literature: Atherton, John H.; Brown, Kathryn H.; Crampton, Michael R. Journal of the Chemical Society. Perkin Transactions 2, 2000 , # 5 p. 941 - 946 |
|
~%
[(4-methylpheny... CAS#:28141-40-4 |
| Literature: Bucherer; Schwalbe Chemische Berichte, 1906 , vol. 39, p. 2801 |
| p-Toluidino-methansulfonsaeure,Natriumsalz |
| p-Methyl-anilinium-N-methansulfonat |
| p-toluidino-methanesulfonic acid,sodium salt |