3-[m-(Allyloxy)phenyl]-1-methyl-3-propylpyrrolidine structure
|
Common Name | 3-[m-(Allyloxy)phenyl]-1-methyl-3-propylpyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 28142-71-4 | Molecular Weight | 259.38600 | |
| Density | 0.965g/cm3 | Boiling Point | 359.7ºC at 760 mmHg | |
| Molecular Formula | C17H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.2ºC | |
| Name | 1-methyl-3-(3-prop-2-enoxyphenyl)-3-propylpyrrolidine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.965g/cm3 |
|---|---|
| Boiling Point | 359.7ºC at 760 mmHg |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.38600 |
| Flash Point | 106.2ºC |
| Exact Mass | 259.19400 |
| PSA | 12.47000 |
| LogP | 3.56270 |
| Vapour Pressure | 2.33E-05mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | UCRYKTFGWVVIRD-UHFFFAOYSA-N |
| SMILES | C=CCOc1cccc(C2(CCC)CCN(C)C2)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(3-allyloxy-phenyl)-1-methyl-3-propyl-pyrrolidine |
| Pyrrolidine,3-(m-allyloxyphenyl)-1-methyl-3-propyl |
| 1-methyl-3-[3-(prop-2-en-1-yloxy)phenyl]-3-propylpyrrolidine |
| 3-(m-Allyloxyphenyl)-1-methyl-3-propylpyrrolidine |