5-Benzylsulfonyl-2-methoxy-aniline structure
|
Common Name | 5-Benzylsulfonyl-2-methoxy-aniline | ||
|---|---|---|---|---|
| CAS Number | 2815-50-1 | Molecular Weight | 277.33900 | |
| Density | 1.271g/cm3 | Boiling Point | 514.4ºC at 760mmHg | |
| Molecular Formula | C14H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.9ºC | |
| Name | 5-benzylsulfonyl-2-methoxyaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.271g/cm3 |
|---|---|
| Boiling Point | 514.4ºC at 760mmHg |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.33900 |
| Flash Point | 264.9ºC |
| Exact Mass | 277.07700 |
| PSA | 77.77000 |
| LogP | 3.91330 |
| Vapour Pressure | 1.09E-10mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | XTTHAADPPZNOBT-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)Cc2ccccc2)cc1N |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Benzylsulphonyl-o-anisidine |
| 5-(benzylsulfonyl)-2-methoxyaniline |
| 2-Methoxy-5-phenylmethanesulfonyl-phenylamine |