1H-Indazole, 1-b-D-ribofuranosyl- structure
|
Common Name | 1H-Indazole, 1-b-D-ribofuranosyl- | ||
|---|---|---|---|---|
| CAS Number | 28152-41-2 | Molecular Weight | 250.25100 | |
| Density | 1.62g/cm3 | Boiling Point | 530.1ºC at 760 mmHg | |
| Molecular Formula | C12H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.4ºC | |
| Name | 2-(hydroxymethyl)-5-indazol-1-yloxolane-3,4-diol |
|---|
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 530.1ºC at 760 mmHg |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25100 |
| Flash Point | 274.4ºC |
| Exact Mass | 250.09500 |
| PSA | 87.74000 |
| Vapour Pressure | 4.58E-12mmHg at 25°C |
| Index of Refraction | 1.724 |
| InChIKey | MWJKKGSEYKFZRA-UHFFFAOYSA-N |
| SMILES | OCC1OC(n2ncc3ccccc32)C(O)C1O |
|
~90%
1H-Indazole, 1-... CAS#:28152-41-2 |
| Literature: Boryski Nucleosides and Nucleotides, 1995 , vol. 14, # 1-2 p. 77 - 89 |
|
~%
1H-Indazole, 1-... CAS#:28152-41-2 |
| Literature: Sagi; Szucs; Vereb; Otvos Journal of Medicinal Chemistry, 1992 , vol. 35, # 24 p. 4549 - 4556 |
|
~%
1H-Indazole, 1-... CAS#:28152-41-2 |
| Literature: Sagi; Szucs; Vereb; Otvos Journal of Medicinal Chemistry, 1992 , vol. 35, # 24 p. 4549 - 4556 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |