2-Oxo-1-phenylcyclohexanepropionic acid structure
|
Common Name | 2-Oxo-1-phenylcyclohexanepropionic acid | ||
|---|---|---|---|---|
| CAS Number | 2819-68-3 | Molecular Weight | 246.30200 | |
| Density | 1.149g/cm3 | Boiling Point | 434.8ºC at 760 mmHg | |
| Molecular Formula | C15H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.9ºC | |
| Name | 3-(2-Oxo-1-phenylcyclohexyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.149g/cm3 |
|---|---|
| Boiling Point | 434.8ºC at 760 mmHg |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.30200 |
| Flash Point | 230.9ºC |
| Exact Mass | 246.12600 |
| PSA | 54.37000 |
| LogP | 2.93230 |
| Vapour Pressure | 2.49E-08mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | ZDCBPGXPFYLDBZ-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC1(c2ccccc2)CCCCC1=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2918300090 |
|---|
|
~85%
2-Oxo-1-phenylc... CAS#:2819-68-3 |
| Literature: BRISTOL-MYERS SQUIBB COMPANY; DAS, Jagabandhu; KO, Soo Sung Patent: WO2012/40532 A1, 2012 ; Location in patent: Page/Page column 36-37 ; WO 2012/040532 A1 |
|
~%
2-Oxo-1-phenylc... CAS#:2819-68-3 |
| Literature: BRISTOL-MYERS SQUIBB COMPANY; DAS, Jagabandhu; KO, Soo Sung Patent: WO2012/40532 A1, 2012 ; WO 2012/040532 A1 |
|
~%
2-Oxo-1-phenylc... CAS#:2819-68-3 |
| Literature: Fischer, Friedrich; Palitzsch, Peter Zeitschrift fuer Chemie (Stuttgart, Germany), 1982 , vol. 22, # 8 p. 309 - 310 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Cyclohexanepropionic acid,2-oxo-1-phenyl |
| 2-Oxo-1-phenylcyclohexanepropionic acid |
| 3-<1-Phenyl-2-oxo-cyclohexyl>-propionsaeure |
| 3-<2-Oxo-1-phenyl-cyclohexyl>-propionsaeure |