Solvent Green 28 structure
|
Common Name | Solvent Green 28 | ||
|---|---|---|---|---|
| CAS Number | 28198-05-2 | Molecular Weight | 534.64500 | |
| Density | 1.273 | Boiling Point | 716.9ºC at 760 mmHg | |
| Molecular Formula | C34H34N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 387.3ºC | |
| Name | Solvent Green 28 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.273 |
|---|---|
| Boiling Point | 716.9ºC at 760 mmHg |
| Molecular Formula | C34H34N2O4 |
| Molecular Weight | 534.64500 |
| Flash Point | 387.3ºC |
| Exact Mass | 534.25200 |
| PSA | 98.66000 |
| LogP | 8.19160 |
| InChIKey | KTEFLEFPDDQMCB-UHFFFAOYSA-N |
| SMILES | CCCCc1ccc(Nc2ccc(Nc3ccc(CCCC)cc3)c3c2C(=O)c2c(O)ccc(O)c2C3=O)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| waxolinegreen5g |
| Macrolex Green G |
| Sandopla |
| Oil Green G |
| sandoplastgreeng |
| Keyplast Green G |