Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate
Modify Date: 2025-10-12 10:36:15
Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate structure
|
Common Name | Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate | ||
|---|---|---|---|---|
| CAS Number | 2822-74-4 | Molecular Weight | 220.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H8ClF3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H8ClF3O3 |
|---|---|
| Molecular Weight | 220.57 |
| InChIKey | QAMIPTZCRRHKNK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cl)C(O)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate? |
| A: The English name of Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate is Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate. |
| Q: What is the Chinese name of 2822-74-4? |
| A: Chinese name of 2822-74-4 is 2822-74-4. |
| Q: What is the SMILES notation of Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate? |
| A: SMILES notation of Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate is CCOC(=O)C(Cl)C(O)C(F)(F)F. |
| Q: What is the CAS number of Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate? |
| A: CAS number of Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate is 2822-74-4. |
| Q: What is the molecular weight of Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate? |
| A: Molecular weight of Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate is 220.57. |
| Q: What is the InChIKey of Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate? |
| A: InChIKey of Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate is QAMIPTZCRRHKNK-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate? |
| A: Molecular formula of Ethyl 2-chloro-4,4,4-trifluoro-3-hydroxybutanoate is C6H8ClF3O3. |