Ethanone,1,1'-(2,5-benzofurandiyl)bis- (9CI) structure
|
Common Name | Ethanone,1,1'-(2,5-benzofurandiyl)bis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 28221-81-0 | Molecular Weight | 202.20600 | |
| Density | 1.193g/cm3 | Boiling Point | 333.4ºC at 760 mmHg | |
| Molecular Formula | C12H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.3ºC | |
| Name | 1-(2-acetyl-1-benzofuran-5-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 333.4ºC at 760 mmHg |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.20600 |
| Flash Point | 155.3ºC |
| Exact Mass | 202.06300 |
| PSA | 47.28000 |
| LogP | 2.83800 |
| Vapour Pressure | 0.000137mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | QKNUQRIOFNUYQG-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2oc(C(C)=O)cc2c1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Acetyl-5-acetylbenzofuran |
| Benzofuran,5-diacetyl |
| Ethanone,1'-(2,5-benzofurandiyl)bis |
| 1,1'-benzofuran-2,5-diyl-bis-ethanone |