(2,6-DIBROMO-5-METHOXY)BENZENEBORONICACID structure
|
Common Name | (2,6-DIBROMO-5-METHOXY)BENZENEBORONICACID | ||
|---|---|---|---|---|
| CAS Number | 28230-47-9 | Molecular Weight | 240.08900 | |
| Density | 1.447g/cm3 | Boiling Point | 387.3ºC at 760mmHg | |
| Molecular Formula | C10H7Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188ºC | |
| Name | 2,6-dichloro-N-phenylpyrimidin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.447g/cm3 |
|---|---|
| Boiling Point | 387.3ºC at 760mmHg |
| Molecular Formula | C10H7Cl2N3 |
| Molecular Weight | 240.08900 |
| Flash Point | 188ºC |
| Exact Mass | 239.00200 |
| PSA | 41.04000 |
| LogP | 2.94890 |
| Vapour Pressure | 3.32E-06mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | WKVVPGGJSMZBKK-UHFFFAOYSA-N |
| SMILES | Clc1cc(Nc2ccccc2)nc(Cl)n1 |
| HS Code | 2933599090 |
|---|
|
~45%
(2,6-DIBROMO-5-... CAS#:28230-47-9 |
| Literature: Mesguiche, Veronique; Parsons, Rachel J; Arris, Christine E; Bentley, Johanne; Boyle, F Thomas; Curtin, Nicola J; Davies, Thomas G; Endicott, Jane A; Gibson, Ashleigh E; Golding, Bernard T; Griffin, Roger J; Jewsbury, Philip; Johnson, Louise N; Newell, David R; Noble, Martin E M; Wang, Lan Z; Hardcastle, Ian R Bioorganic and medicinal chemistry letters, 2003 , vol. 13, # 2 p. 217 - 222 |
|
~0%
(2,6-DIBROMO-5-... CAS#:28230-47-9 |
| Literature: Bratt, Jack; Iddon, Brian; Mack, Arthur G.; Suschitzky, Hans; Taylor, Jack A.; Wakefield, Basil J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 648 - 656 |
|
~%
(2,6-DIBROMO-5-... CAS#:28230-47-9 |
| Literature: Winkelmann Journal fuer Praktische Chemie (Leipzig), 1927 , vol. <2> 115, p. 293 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2,6-Dichlor-pyrimidin-4-yl)-phenyl-amin |
| 2,6-Dichloro-N-Phenyl-4-Pyrimidinamine |
| (2,6-Dichloro-pyrimidin-4-yl)-phenyl-amine |
| 2,4-dichloro-6-(phenylamino)pyrimidine |
| 4-Pyrimidinamine,2,6-dichloro-N-phenyl |
| 4-anilino-2,6-dichloropyrimidine |
| 2,6-Dichlor-4-anilino-pyrimidin |