3-Bromo-5-(4-chlorophenoxy)pyridine structure
|
Common Name | 3-Bromo-5-(4-chlorophenoxy)pyridine | ||
|---|---|---|---|---|
| CAS Number | 28232-66-8 | Molecular Weight | 284.53600 | |
| Density | 1.568 | Boiling Point | 341.402ºC at 760 mmHg | |
| Molecular Formula | C11H7BrClNO | Melting Point | 79ºC | |
| MSDS | N/A | Flash Point | 160.274ºC | |
| Name | 3-Bromo-5-(4-chlorophenoxy)pyridine |
|---|
| Density | 1.568 |
|---|---|
| Boiling Point | 341.402ºC at 760 mmHg |
| Melting Point | 79ºC |
| Molecular Formula | C11H7BrClNO |
| Molecular Weight | 284.53600 |
| Flash Point | 160.274ºC |
| Exact Mass | 282.94000 |
| PSA | 22.12000 |
| LogP | 4.28980 |
| Index of Refraction | 1.616 |
| InChIKey | WBVDIRRTMMAHKU-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Oc2cncc(Br)c2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |