tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate
Modify Date: 2026-08-02 14:25:03
![tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate Structure](https://www.chemsrc.com/extcaspic/431/2825057-13-2.png)
tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate structure
|
Common Name | tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 2825057-13-2 | Molecular Weight | 240.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H24N2O2 |
|---|---|
| Molecular Weight | 240.34 |
| InChIKey | ZZMWESKJZMDOFJ-UHFFFAOYSA-N |
| SMILES | CN(C(=O)OC(C)(C)C)C12CCC(CNC1)C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2825057-13-2? |
| A: Chinese name of 2825057-13-2 is 2825057-13-2. |
| Q: What is the InChIKey of tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate? |
| A: InChIKey of tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate is ZZMWESKJZMDOFJ-UHFFFAOYSA-N. |
| Q: What is the CAS number of tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate? |
| A: CAS number of tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate is 2825057-13-2. |
| Q: What is the molecular weight of tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate? |
| A: Molecular weight of tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate is 240.34. |
| Q: What is the SMILES notation of tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate? |
| A: SMILES notation of tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate is CN(C(=O)OC(C)(C)C)C12CCC(CNC1)C2. |
| Q: What is the molecular formula of tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate? |
| A: Molecular formula of tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate is C13H24N2O2. |
| Q: What is the English name of tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate? |
| A: The English name of tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate is tert-butyl N-{3-azabicyclo[3.2.1]octan-1-yl}-N-methylcarbamate. |