11,1-Metheno-1H-cyclohepta[b]heptalene,11a,12,13,13a-tetrahydro- structure
|
Common Name | 11,1-Metheno-1H-cyclohepta[b]heptalene,11a,12,13,13a-tetrahydro- | ||
|---|---|---|---|---|
| CAS Number | 28255-97-2 | Molecular Weight | 234.33600 | |
| Density | 1.13g/cm3 | Boiling Point | 512.7ºC at 760mmHg | |
| Molecular Formula | C18H18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.8ºC | |
| Name | 1,6:8,13-butanediylidene<14>annulene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 512.7ºC at 760mmHg |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.33600 |
| Flash Point | 224.8ºC |
| Exact Mass | 234.14100 |
| LogP | 4.50750 |
| Vapour Pressure | 4.07E-10mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | XNJNSGJEBSIKOD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C=CC=CC4=CC(=C1)C2CCC43 |
| HS Code | 2902199090 |
|---|
| HS Code | 2902199090 |
|---|---|
| Summary | 2902199090 other cyclanes, cyclenes and cyclotherpenes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| XNJNSGJEBSIKOD-UHFFFAOYSA |
| 1,6:8,13-Butan-1,4-diyliden<14>annulen |